C13H13N5O5P- — CID 135778775
[3-[(2-amino-6-oxo-1H-purin-9-yl)methyl]phenoxy]methyl-hydroxyphosphinate (PubChem CID 135778775) has the molecular formula C13H13N5O5P- and a molecular weight of 350.25 g/mol. Its IUPAC name is [3-[(2-amino-6-oxo-1H-purin-9-yl)methyl]phenoxy]methyl-hydroxyphosphinate.
| Compound Name | [3-[(2-amino-6-oxo-1H-purin-9-yl)methyl]phenoxy]methyl-hydroxyphosphinate |
|---|---|
| PubChem CID | 135778775 |
| Molecular Formula | C13H13N5O5P- |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | [3-[(2-amino-6-oxo-1H-purin-9-yl)methyl]phenoxy]methyl-hydroxyphosphinate |
| SMILES | Nc1nc2c(ncn2Cc2cccc(OCP(=O)([O-])O)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C13H14N5O5P/c14-13-16-11-10(12(19)17-13)15-6-18(11)5-8-2-1-3-9(4-8)23-7-24(20,21)22/h1-4,6H,5,7H2,(H2,20,21,22)(H3,14,16,17,19)/p-1 |
| InChIKey | WXZSLCNKZFORPD-UHFFFAOYSA-M |
| XLogP | -0.37 |
| TPSA | 159.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|