C13H13BrClN5O — CID 136934356
2-amino-9-[(4-bromo-3-methylphenyl)methyl]-1H-purin-6-one;hydrochloride (PubChem CID 136934356) has the molecular formula C13H13BrClN5O and a molecular weight of 370.64 g/mol. Its IUPAC name is 2-amino-9-[(4-bromo-3-methylphenyl)methyl]-1H-purin-6-one;hydrochloride.
| Compound Name | 2-amino-9-[(4-bromo-3-methylphenyl)methyl]-1H-purin-6-one;hydrochloride |
|---|---|
| PubChem CID | 136934356 |
| Molecular Formula | C13H13BrClN5O |
| Molecular Weight | 370.64 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | 2-amino-9-[(4-bromo-3-methylphenyl)methyl]-1H-purin-6-one;hydrochloride |
| SMILES | Cc1cc(Cn2cnc3c(=O)[nH]c(N)nc32)ccc1Br.Cl |
| InChI | InChI=1S/C13H12BrN5O.ClH/c1-7-4-8(2-3-9(7)14)5-19-6-16-10-11(19)17-13(15)18-12(10)20;/h2-4,6H,5H2,1H3,(H3,15,17,18,20);1H |
| InChIKey | FXXSANGXQPXPCL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.64 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |