C9H16N7O4+ — CID 137082230
[1-(2-amino-6-oxo-1H-purin-9-yl)propan-2-ylamino]methyl-trihydroxyazanium (PubChem CID 137082230) has the molecular formula C9H16N7O4+ and a molecular weight of 286.27 g/mol. Its IUPAC name is [1-(2-amino-6-oxo-1H-purin-9-yl)propan-2-ylamino]methyl-trihydroxyazanium.
| Compound Name | [1-(2-amino-6-oxo-1H-purin-9-yl)propan-2-ylamino]methyl-trihydroxyazanium |
|---|---|
| PubChem CID | 137082230 |
| Molecular Formula | C9H16N7O4+ |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | [1-(2-amino-6-oxo-1H-purin-9-yl)propan-2-ylamino]methyl-trihydroxyazanium |
| SMILES | CC(Cn1cnc2c(=O)[nH]c(N)nc21)NC[N+](O)(O)O |
| InChI | InChI=1S/C9H15N7O4/c1-5(12-4-16(18,19)20)2-15-3-11-6-7(15)13-9(10)14-8(6)17/h3,5,12,18-20H,2,4H2,1H3,(H2-,10,13,14,17)/p+1 |
| InChIKey | AIGWTLDLQCOBPK-UHFFFAOYSA-O |
| XLogP | -1.38 |
| TPSA | 162.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|