C18H19N5O9 — CID 140732342
4-O-[3-(2-amino-6-oxo-1H-purin-9-yl)-2-[(E)-4-methoxy-4-oxobut-2-enoyl]oxypropyl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 140732342) has the molecular formula C18H19N5O9 and a molecular weight of 449.38 g/mol. Its IUPAC name is 4-O-[3-(2-amino-6-oxo-1H-purin-9-yl)-2-[(E)-4-methoxy-4-oxobut-2-enoyl]oxypropyl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[3-(2-amino-6-oxo-1H-purin-9-yl)-2-[(E)-4-methoxy-4-oxobut-2-enoyl]oxypropyl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 140732342 |
| Molecular Formula | C18H19N5O9 |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 4-O-[3-(2-amino-6-oxo-1H-purin-9-yl)-2-[(E)-4-methoxy-4-oxobut-2-enoyl]oxypropyl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)OCC(Cn1cnc2c(=O)[nH]c(N)nc21)OC(=O)/C=C/C(=O)OC |
| InChI | InChI=1S/C18H19N5O9/c1-29-11(24)3-5-13(26)31-8-10(32-14(27)6-4-12(25)30-2)7-23-9-20-15-16(23)21-18(19)22-17(15)28/h3-6,9-10H,7-8H2,1-2H3,(H3,19,21,22,28)/b5-3+,6-4+ |
| InChIKey | QMBDARBNEKDFAC-GGWOSOGESA-N |
| XLogP | -1.38 |
| TPSA | 194.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|