C17H19N3O9 — CID 140732339
4-O-[3-(4-amino-2-oxopyrimidin-1-yl)-2-[(E)-4-methoxy-4-oxobut-2-enoyl]oxypropyl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 140732339) has the molecular formula C17H19N3O9 and a molecular weight of 409.35 g/mol. Its IUPAC name is 4-O-[3-(4-amino-2-oxopyrimidin-1-yl)-2-[(E)-4-methoxy-4-oxobut-2-enoyl]oxypropyl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[3-(4-amino-2-oxopyrimidin-1-yl)-2-[(E)-4-methoxy-4-oxobut-2-enoyl]oxypropyl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 140732339 |
| Molecular Formula | C17H19N3O9 |
| Molecular Weight | 409.35 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 4-O-[3-(4-amino-2-oxopyrimidin-1-yl)-2-[(E)-4-methoxy-4-oxobut-2-enoyl]oxypropyl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)OCC(Cn1ccc(N)nc1=O)OC(=O)/C=C/C(=O)OC |
| InChI | InChI=1S/C17H19N3O9/c1-26-13(21)3-5-15(23)28-10-11(29-16(24)6-4-14(22)27-2)9-20-8-7-12(18)19-17(20)25/h3-8,11H,9-10H2,1-2H3,(H2,18,19,25)/b5-3+,6-4+ |
| InChIKey | BFCXOVRLPZRVTP-GGWOSOGESA-N |
| XLogP | -1.26 |
| TPSA | 166.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.35 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|