C8H17N3O10P2 — CID 174487238
[1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid;phosphoric acid (PubChem CID 174487238) has the molecular formula C8H17N3O10P2 and a molecular weight of 377.18 g/mol. Its IUPAC name is [1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid;phosphoric acid.
| Compound Name | [1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid;phosphoric acid |
|---|---|
| PubChem CID | 174487238 |
| Molecular Formula | C8H17N3O10P2 |
| Molecular Weight | 377.18 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | [1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid;phosphoric acid |
| SMILES | Nc1ccn(CC(CO)OCP(=O)(O)O)c(=O)n1.O=P(O)(O)O |
| InChI | InChI=1S/C8H14N3O6P.H3O4P/c9-7-1-2-11(8(13)10-7)3-6(4-12)17-5-18(14,15)16;1-5(2,3)4/h1-2,6,12H,3-5H2,(H2,9,10,13)(H2,14,15,16);(H3,1,2,3,4) |
| InChIKey | XLLRDPOTZPZUNL-UHFFFAOYSA-N |
| XLogP | -2.59 |
| TPSA | 225.66 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.18 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|