About Adamantan-1-amine;[1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid
Adamantan-1-amine;[1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid (PubChem CID 174796348) has the molecular formula C18H31N4O6P
and a molecular weight of 430.40 g/mol. Its IUPAC name is adamantan-1-amine;[1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid.
Molecular Properties
| Compound Name | Adamantan-1-amine;[1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid |
| PubChem CID | 174796348 |
| Molecular Formula | C18H31N4O6P |
| Molecular Weight | 430.40 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | adamantan-1-amine;[1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid |
| SMILES | C1C2CC3CC1CC(C2)(C3)N.C1=CN(C(=O)N=C1N)CC(CO)OCP(=O)(O)O |
| InChI | InChI=1S/C10H17N.C8H14N3O6P/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;9-7-1-2-11(8(13)10-7)3-6(4-12)17-5-18(14,15)16/h7-9H,1-6,11H2;1-2,6,12H,3-5H2,(H2,9,10,13)(H2,14,15,16) |
| InChIKey | DFRRDXWCMDEHQN-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 172.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | 561 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze Adamantan-1-amine;[1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Adamantan-1-amine;[1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid?
The IUPAC name of Adamantan-1-amine;[1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid (CID 174796348) is adamantan-1-amine;[1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid.
What is the SMILES notation for Adamantan-1-amine;[1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid?
The canonical SMILES for Adamantan-1-amine;[1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid is C1C2CC3CC1CC(C2)(C3)N.C1=CN(C(=O)N=C1N)CC(CO)OCP(=O)(O)O.
What is the InChIKey of Adamantan-1-amine;[1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid?
The InChIKey is DFRRDXWCMDEHQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N.C8H14N3O6P/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;9-7-1-2-11(8(13)10-7)3-6(4-12)17-5-18(14,15)16/h7-9H,1-6,11H2;1-2,6,12H,3-5H2,(H2,9,10,13)(H2,14,15,16).
What are the key properties of Adamantan-1-amine;[1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid?
Adamantan-1-amine;[1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid has a molecular weight of 430.40 g/mol, XLogP of not available, 6 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for Adamantan-1-amine;[1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid is sourced from PubChem (CID 174796348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).