C14H18N3O6P — CID 23629625
[(2R)-1-(4-amino-2-oxo-5-phenylpyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid (PubChem CID 23629625) has the molecular formula C14H18N3O6P and a molecular weight of 355.29 g/mol. Its IUPAC name is [(2R)-1-(4-amino-2-oxo-5-phenylpyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid.
| Compound Name | [(2R)-1-(4-amino-2-oxo-5-phenylpyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 23629625 |
| Molecular Formula | C14H18N3O6P |
| Molecular Weight | 355.29 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | [(2R)-1-(4-amino-2-oxo-5-phenylpyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid |
| SMILES | Nc1nc(=O)n(C[C@H](CO)OCP(=O)(O)O)cc1-c1ccccc1 |
| InChI | InChI=1S/C14H18N3O6P/c15-13-12(10-4-2-1-3-5-10)7-17(14(19)16-13)6-11(8-18)23-9-24(20,21)22/h1-5,7,11,18H,6,8-9H2,(H2,15,16,19)(H2,20,21,22)/t11-/m1/s1 |
| InChIKey | DYORBYNPHFZVHW-LLVKDONJSA-N |
| XLogP | 0.01 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.29 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|