C8H14N3O3P — CID 57318291
4-amino-1-[3-hydroxy-2-(phosphanylmethoxy)propyl]pyrimidin-2-one (PubChem CID 57318291) has the molecular formula C8H14N3O3P and a molecular weight of 231.19 g/mol. Its IUPAC name is 4-amino-1-[3-hydroxy-2-(phosphanylmethoxy)propyl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[3-hydroxy-2-(phosphanylmethoxy)propyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 57318291 |
| Molecular Formula | C8H14N3O3P |
| Molecular Weight | 231.19 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 4-amino-1-[3-hydroxy-2-(phosphanylmethoxy)propyl]pyrimidin-2-one |
| SMILES | Nc1ccn(CC(CO)OCP)c(=O)n1 |
| InChI | InChI=1S/C8H14N3O3P/c9-7-1-2-11(8(13)10-7)3-6(4-12)14-5-15/h1-2,6,12H,3-5,15H2,(H2,9,10,13) |
| InChIKey | WVJDGCLYHVUVQE-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.19 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|