C8H10N3O4P — CID 141054524
4-amino-1-[3-hydroxy-2-[(oxo-λ5-phosphanylidyne)methoxy]propyl]pyrimidin-2-one (PubChem CID 141054524) has the molecular formula C8H10N3O4P and a molecular weight of 243.16 g/mol. Its IUPAC name is 4-amino-1-[3-hydroxy-2-[(oxo-λ5-phosphanylidyne)methoxy]propyl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[3-hydroxy-2-[(oxo-λ5-phosphanylidyne)methoxy]propyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 141054524 |
| Molecular Formula | C8H10N3O4P |
| Molecular Weight | 243.16 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | 4-amino-1-[3-hydroxy-2-[(oxo-λ5-phosphanylidyne)methoxy]propyl]pyrimidin-2-one |
| SMILES | Nc1ccn(CC(CO)OC#P=O)c(=O)n1 |
| InChI | InChI=1S/C8H10N3O4P/c9-7-1-2-11(8(13)10-7)3-6(4-12)15-5-16-14/h1-2,6,12H,3-4H2,(H2,9,10,13) |
| InChIKey | XSAOEQQDDSFIHG-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.16 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|