C11H20N4O4 — CID 123396740
4-amino-1-(5-amino-3,4,6-trihydroxy-2-methylhexyl)pyrimidin-2-one (PubChem CID 123396740) has the molecular formula C11H20N4O4 and a molecular weight of 272.31 g/mol. Its IUPAC name is 4-amino-1-(5-amino-3,4,6-trihydroxy-2-methylhexyl)pyrimidin-2-one.
| Compound Name | 4-amino-1-(5-amino-3,4,6-trihydroxy-2-methylhexyl)pyrimidin-2-one |
|---|---|
| PubChem CID | 123396740 |
| Molecular Formula | C11H20N4O4 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 4-amino-1-(5-amino-3,4,6-trihydroxy-2-methylhexyl)pyrimidin-2-one |
| SMILES | CC(Cn1ccc(N)nc1=O)C(O)C(O)C(N)CO |
| InChI | InChI=1S/C11H20N4O4/c1-6(9(17)10(18)7(12)5-16)4-15-3-2-8(13)14-11(15)19/h2-3,6-7,9-10,16-18H,4-5,12H2,1H3,(H2,13,14,19) |
| InChIKey | YICBDGQAVXGQND-UHFFFAOYSA-N |
| XLogP | -2.50 |
| TPSA | 147.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |