C8H15N4O5P — CID 11565998
[[1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]amino]methylphosphonic acid (PubChem CID 11565998) has the molecular formula C8H15N4O5P and a molecular weight of 278.20 g/mol. Its IUPAC name is [[1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]amino]methylphosphonic acid.
| Compound Name | [[1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]amino]methylphosphonic acid |
|---|---|
| PubChem CID | 11565998 |
| Molecular Formula | C8H15N4O5P |
| Molecular Weight | 278.20 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | [[1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]amino]methylphosphonic acid |
| SMILES | Nc1ccn(CC(CO)NCP(=O)(O)O)c(=O)n1 |
| InChI | InChI=1S/C8H15N4O5P/c9-7-1-2-12(8(14)11-7)3-6(4-13)10-5-18(15,16)17/h1-2,6,10,13H,3-5H2,(H2,9,11,14)(H2,15,16,17) |
| InChIKey | LNYWZXMRJJNXGC-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.20 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|