C8H16N3O6PS — CID 157233007
[(2S)-1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid;sulfane (PubChem CID 157233007) has the molecular formula C8H16N3O6PS and a molecular weight of 313.27 g/mol. Its IUPAC name is [(2S)-1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid;sulfane.
| Compound Name | [(2S)-1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid;sulfane |
|---|---|
| PubChem CID | 157233007 |
| Molecular Formula | C8H16N3O6PS |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | [(2S)-1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid;sulfane |
| SMILES | Nc1ccn(C[C@@H](CO)OCP(=O)(O)O)c(=O)n1.S |
| InChI | InChI=1S/C8H14N3O6P.H2S/c9-7-1-2-11(8(13)10-7)3-6(4-12)17-5-18(14,15)16;/h1-2,6,12H,3-5H2,(H2,9,10,13)(H2,14,15,16);1H2/t6-;/m0./s1 |
| InChIKey | AUHWCVSVOLPGOK-RGMNGODLSA-N |
| XLogP | -1.55 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|