C10H19N4O2+ — CID 10515656
[3-(4-amino-2-oxopyrimidin-1-yl)-2-hydroxypropyl]-trimethylazanium (PubChem CID 10515656) has the molecular formula C10H19N4O2+ and a molecular weight of 227.29 g/mol. Its IUPAC name is [3-(4-amino-2-oxopyrimidin-1-yl)-2-hydroxypropyl]-trimethylazanium.
| Compound Name | [3-(4-amino-2-oxopyrimidin-1-yl)-2-hydroxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 10515656 |
| Molecular Formula | C10H19N4O2+ |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | [3-(4-amino-2-oxopyrimidin-1-yl)-2-hydroxypropyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(O)Cn1ccc(N)nc1=O |
| InChI | InChI=1S/C10H18N4O2/c1-14(2,3)7-8(15)6-13-5-4-9(11)12-10(13)16/h4-5,8,15H,6-7H2,1-3H3,(H-,11,12,16)/p+1 |
| InChIKey | UPSYJTRNDPQRKK-UHFFFAOYSA-O |
| XLogP | -1.11 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|