C8H13FN3O2P — CID 67643437
4-amino-1-[3-fluoro-2-(phosphanylmethoxy)propyl]pyrimidin-2-one (PubChem CID 67643437) has the molecular formula C8H13FN3O2P and a molecular weight of 233.18 g/mol. Its IUPAC name is 4-amino-1-[3-fluoro-2-(phosphanylmethoxy)propyl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[3-fluoro-2-(phosphanylmethoxy)propyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 67643437 |
| Molecular Formula | C8H13FN3O2P |
| Molecular Weight | 233.18 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 4-amino-1-[3-fluoro-2-(phosphanylmethoxy)propyl]pyrimidin-2-one |
| SMILES | Nc1ccn(CC(CF)OCP)c(=O)n1 |
| InChI | InChI=1S/C8H13FN3O2P/c9-3-6(14-5-15)4-12-2-1-7(10)11-8(12)13/h1-2,6H,3-5,15H2,(H2,10,11,13) |
| InChIKey | WENCGRFIQASLGU-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.18 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|