C11H20N3O5P — CID 20652005
4-amino-1-[2-(dimethoxyphosphorylmethoxy)butyl]pyrimidin-2-one (PubChem CID 20652005) has the molecular formula C11H20N3O5P and a molecular weight of 305.27 g/mol. Its IUPAC name is 4-amino-1-[2-(dimethoxyphosphorylmethoxy)butyl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[2-(dimethoxyphosphorylmethoxy)butyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 20652005 |
| Molecular Formula | C11H20N3O5P |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 4-amino-1-[2-(dimethoxyphosphorylmethoxy)butyl]pyrimidin-2-one |
| SMILES | CCC(Cn1ccc(N)nc1=O)OCP(=O)(OC)OC |
| InChI | InChI=1S/C11H20N3O5P/c1-4-9(19-8-20(16,17-2)18-3)7-14-6-5-10(12)13-11(14)15/h5-6,9H,4,7-8H2,1-3H3,(H2,12,13,15) |
| InChIKey | KNIVBCBBJQLZFI-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|