C9H12N4O3 — CID 70375406
3-[(4-amino-2-oxopyrimidin-1-yl)methoxy]-4-hydroxybutanenitrile (PubChem CID 70375406) has the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is 3-[(4-amino-2-oxopyrimidin-1-yl)methoxy]-4-hydroxybutanenitrile.
| Compound Name | 3-[(4-amino-2-oxopyrimidin-1-yl)methoxy]-4-hydroxybutanenitrile |
|---|---|
| PubChem CID | 70375406 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 3-[(4-amino-2-oxopyrimidin-1-yl)methoxy]-4-hydroxybutanenitrile |
| SMILES | N#CCC(CO)OCn1ccc(N)nc1=O |
| InChI | InChI=1S/C9H12N4O3/c10-3-1-7(5-14)16-6-13-4-2-8(11)12-9(13)15/h2,4,7,14H,1,5-6H2,(H2,11,12,15) |
| InChIKey | WHGCSMCAVXVLTF-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 114.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |