C9H13N3O4S — CID 5481517
[(2S)-2-[(4-amino-2-oxopyrimidin-1-yl)methoxy]-2-sulfanylethyl] acetate (PubChem CID 5481517) has the molecular formula C9H13N3O4S and a molecular weight of 259.29 g/mol. Its IUPAC name is [(2S)-2-[(4-amino-2-oxopyrimidin-1-yl)methoxy]-2-sulfanylethyl] acetate.
| Compound Name | [(2S)-2-[(4-amino-2-oxopyrimidin-1-yl)methoxy]-2-sulfanylethyl] acetate |
|---|---|
| PubChem CID | 5481517 |
| Molecular Formula | C9H13N3O4S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | [(2S)-2-[(4-amino-2-oxopyrimidin-1-yl)methoxy]-2-sulfanylethyl] acetate |
| SMILES | CC(=O)OC[C@H](S)OCn1ccc(N)nc1=O |
| InChI | InChI=1S/C9H13N3O4S/c1-6(13)15-4-8(17)16-5-12-3-2-7(10)11-9(12)14/h2-3,8,17H,4-5H2,1H3,(H2,10,11,14)/t8-/m0/s1 |
| InChIKey | VYLPZYMUFXOFFA-QMMMGPOBSA-N |
| XLogP | -0.38 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|