C9H16N3O6P — CID 137398895
[4-(4-amino-2-oxopyrimidin-1-yl)-2-methoxybutyl] dihydrogen phosphate (PubChem CID 137398895) has the molecular formula C9H16N3O6P and a molecular weight of 293.22 g/mol. Its IUPAC name is [4-(4-amino-2-oxopyrimidin-1-yl)-2-methoxybutyl] dihydrogen phosphate.
| Compound Name | [4-(4-amino-2-oxopyrimidin-1-yl)-2-methoxybutyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 137398895 |
| Molecular Formula | C9H16N3O6P |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | [4-(4-amino-2-oxopyrimidin-1-yl)-2-methoxybutyl] dihydrogen phosphate |
| SMILES | COC(CCn1ccc(N)nc1=O)COP(=O)(O)O |
| InChI | InChI=1S/C9H16N3O6P/c1-17-7(6-18-19(14,15)16)2-4-12-5-3-8(10)11-9(12)13/h3,5,7H,2,4,6H2,1H3,(H2,10,11,13)(H2,14,15,16) |
| InChIKey | QAUQGASROQMWSL-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 136.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|