C10H18N3O7P — CID 90410011
2-(4-amino-2-oxopyrimidin-1-yl)ethoxymethyl-(2,3-dihydroxypropoxy)phosphinic acid (PubChem CID 90410011) has the molecular formula C10H18N3O7P and a molecular weight of 323.24 g/mol. Its IUPAC name is 2-(4-amino-2-oxopyrimidin-1-yl)ethoxymethyl-(2,3-dihydroxypropoxy)phosphinic acid.
| Compound Name | 2-(4-amino-2-oxopyrimidin-1-yl)ethoxymethyl-(2,3-dihydroxypropoxy)phosphinic acid |
|---|---|
| PubChem CID | 90410011 |
| Molecular Formula | C10H18N3O7P |
| Molecular Weight | 323.24 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 2-(4-amino-2-oxopyrimidin-1-yl)ethoxymethyl-(2,3-dihydroxypropoxy)phosphinic acid |
| SMILES | Nc1ccn(CCOCP(=O)(O)OCC(O)CO)c(=O)n1 |
| InChI | InChI=1S/C10H18N3O7P/c11-9-1-2-13(10(16)12-9)3-4-19-7-21(17,18)20-6-8(15)5-14/h1-2,8,14-15H,3-7H2,(H,17,18)(H2,11,12,16) |
| InChIKey | OJYASKXQAOZZQL-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 157.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.24 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|