C12H22N3O6P — CID 10640513
4-amino-1-[2-(1-diethoxyphosphoryl-2-hydroxyethoxy)ethyl]pyrimidin-2-one (PubChem CID 10640513) has the molecular formula C12H22N3O6P and a molecular weight of 335.30 g/mol. Its IUPAC name is 4-amino-1-[2-(1-diethoxyphosphoryl-2-hydroxyethoxy)ethyl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[2-(1-diethoxyphosphoryl-2-hydroxyethoxy)ethyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 10640513 |
| Molecular Formula | C12H22N3O6P |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 4-amino-1-[2-(1-diethoxyphosphoryl-2-hydroxyethoxy)ethyl]pyrimidin-2-one |
| SMILES | CCOP(=O)(OCC)C(CO)OCCn1ccc(N)nc1=O |
| InChI | InChI=1S/C12H22N3O6P/c1-3-20-22(18,21-4-2)11(9-16)19-8-7-15-6-5-10(13)14-12(15)17/h5-6,11,16H,3-4,7-9H2,1-2H3,(H2,13,14,17) |
| InChIKey | RSDPOSVSHSGLTO-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|