C14H18N3O5P — CID 134309613
4-amino-1-[2-[[methoxy(phenoxy)phosphoryl]methoxy]ethyl]pyrimidin-2-one (PubChem CID 134309613) has the molecular formula C14H18N3O5P and a molecular weight of 339.29 g/mol. Its IUPAC name is 4-amino-1-[2-[[methoxy(phenoxy)phosphoryl]methoxy]ethyl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[2-[[methoxy(phenoxy)phosphoryl]methoxy]ethyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 134309613 |
| Molecular Formula | C14H18N3O5P |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 4-amino-1-[2-[[methoxy(phenoxy)phosphoryl]methoxy]ethyl]pyrimidin-2-one |
| SMILES | COP(=O)(COCCn1ccc(N)nc1=O)Oc1ccccc1 |
| InChI | InChI=1S/C14H18N3O5P/c1-20-23(19,22-12-5-3-2-4-6-12)11-21-10-9-17-8-7-13(15)16-14(17)18/h2-8H,9-11H2,1H3,(H2,15,16,18) |
| InChIKey | HWAPHJNFSPGDMV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|