C9H12N3O5P — CID 3009334
4-(4-amino-2-oxopyrimidin-1-yl)but-2-ynoxymethylphosphonic acid (PubChem CID 3009334) has the molecular formula C9H12N3O5P and a molecular weight of 273.19 g/mol. Its IUPAC name is 4-(4-amino-2-oxopyrimidin-1-yl)but-2-ynoxymethylphosphonic acid.
| Compound Name | 4-(4-amino-2-oxopyrimidin-1-yl)but-2-ynoxymethylphosphonic acid |
|---|---|
| PubChem CID | 3009334 |
| Molecular Formula | C9H12N3O5P |
| Molecular Weight | 273.19 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 4-(4-amino-2-oxopyrimidin-1-yl)but-2-ynoxymethylphosphonic acid |
| SMILES | Nc1ccn(CC#CCOCP(=O)(O)O)c(=O)n1 |
| InChI | InChI=1S/C9H12N3O5P/c10-8-3-5-12(9(13)11-8)4-1-2-6-17-7-18(14,15)16/h3,5H,4,6-7H2,(H2,10,11,13)(H2,14,15,16) |
| InChIKey | NLBZZOTUEOLIIM-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.19 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|