C8H14N3O5P — CID 90410031
1-(4-amino-2-oxopyrimidin-1-yl)propoxymethylphosphonic acid (PubChem CID 90410031) has the molecular formula C8H14N3O5P and a molecular weight of 263.19 g/mol. Its IUPAC name is 1-(4-amino-2-oxopyrimidin-1-yl)propoxymethylphosphonic acid.
| Compound Name | 1-(4-amino-2-oxopyrimidin-1-yl)propoxymethylphosphonic acid |
|---|---|
| PubChem CID | 90410031 |
| Molecular Formula | C8H14N3O5P |
| Molecular Weight | 263.19 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 1-(4-amino-2-oxopyrimidin-1-yl)propoxymethylphosphonic acid |
| SMILES | CCC(OCP(=O)(O)O)n1ccc(N)nc1=O |
| InChI | InChI=1S/C8H14N3O5P/c1-2-7(16-5-17(13,14)15)11-4-3-6(9)10-8(11)12/h3-4,7H,2,5H2,1H3,(H2,9,10,12)(H2,13,14,15) |
| InChIKey | JQPPORIFJDMNTQ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.19 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|