C12H21N3O4 — CID 71212015
4-amino-1-[1-[(3R,4R)-4,5-dihydroxyhexan-3-yl]oxyethyl]pyrimidin-2-one (PubChem CID 71212015) has the molecular formula C12H21N3O4 and a molecular weight of 271.32 g/mol. Its IUPAC name is 4-amino-1-[1-[(3R,4R)-4,5-dihydroxyhexan-3-yl]oxyethyl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[1-[(3R,4R)-4,5-dihydroxyhexan-3-yl]oxyethyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 71212015 |
| Molecular Formula | C12H21N3O4 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 4-amino-1-[1-[(3R,4R)-4,5-dihydroxyhexan-3-yl]oxyethyl]pyrimidin-2-one |
| SMILES | CC[C@@H](OC(C)n1ccc(N)nc1=O)[C@H](O)C(C)O |
| InChI | InChI=1S/C12H21N3O4/c1-4-9(11(17)7(2)16)19-8(3)15-6-5-10(13)14-12(15)18/h5-9,11,16-17H,4H2,1-3H3,(H2,13,14,18)/t7?,8?,9-,11-/m1/s1 |
| InChIKey | KNTULSRYZXMJPZ-RSWAIMACSA-N |
| XLogP | -0.12 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |