C11H22FN3O3S2 — CID 144985274
CID 144985274 (PubChem CID 144985274) has the molecular formula C11H22FN3O3S2 and a molecular weight of 327.45 g/mol.
| Compound Name | CID 144985274 |
|---|---|
| PubChem CID | 144985274 |
| Molecular Formula | C11H22FN3O3S2 |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | — |
| SMILES | CC.CC(OC(CO)CF)n1ccc(N)nc1=O.SS |
| InChI | InChI=1S/C9H14FN3O3.C2H6.H2S2/c1-6(16-7(4-10)5-14)13-3-2-8(11)12-9(13)15;2*1-2/h2-3,6-7,14H,4-5H2,1H3,(H2,11,12,15);1-2H3;1-2H |
| InChIKey | MYAQZOQRFKNUSP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|