C9H13N3O5 — CID 170585290
2-[1-(4-amino-2-oxopyrimidin-1-yl)-2-hydroxyethoxy]-3-hydroxypropanal (PubChem CID 170585290) has the molecular formula C9H13N3O5 and a molecular weight of 243.22 g/mol. Its IUPAC name is 2-[1-(4-amino-2-oxopyrimidin-1-yl)-2-hydroxyethoxy]-3-hydroxypropanal.
| Compound Name | 2-[1-(4-amino-2-oxopyrimidin-1-yl)-2-hydroxyethoxy]-3-hydroxypropanal |
|---|---|
| PubChem CID | 170585290 |
| Molecular Formula | C9H13N3O5 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 2-[1-(4-amino-2-oxopyrimidin-1-yl)-2-hydroxyethoxy]-3-hydroxypropanal |
| SMILES | Nc1ccn(C(CO)OC(C=O)CO)c(=O)n1 |
| InChI | InChI=1S/C9H13N3O5/c10-7-1-2-12(9(16)11-7)8(5-15)17-6(3-13)4-14/h1-3,6,8,14-15H,4-5H2,(H2,10,11,16) |
| InChIKey | XEEXQVHZSALCSP-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|