C10H17N3O5 — CID 129301961
4-amino-1-[(1R,2R,3R)-2,4-dihydroxy-1,3-dimethoxybutyl]pyrimidin-2-one (PubChem CID 129301961) has the molecular formula C10H17N3O5 and a molecular weight of 259.26 g/mol. Its IUPAC name is 4-amino-1-[(1R,2R,3R)-2,4-dihydroxy-1,3-dimethoxybutyl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(1R,2R,3R)-2,4-dihydroxy-1,3-dimethoxybutyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 129301961 |
| Molecular Formula | C10H17N3O5 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 4-amino-1-[(1R,2R,3R)-2,4-dihydroxy-1,3-dimethoxybutyl]pyrimidin-2-one |
| SMILES | CO[C@H]([C@H](O)[C@@H](CO)OC)n1ccc(N)nc1=O |
| InChI | InChI=1S/C10H17N3O5/c1-17-6(5-14)8(15)9(18-2)13-4-3-7(11)12-10(13)16/h3-4,6,8-9,14-15H,5H2,1-2H3,(H2,11,12,16)/t6-,8-,9-/m1/s1 |
| InChIKey | SCZDPAYNGFSEQT-FTLITQJKSA-N |
| XLogP | -1.66 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |