C28H28N4O4Si — CID 163784328
(2S,3S,4R)-2-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxy-4-methoxy-5-triphenylsilyloxypentanenitrile (PubChem CID 163784328) has the molecular formula C28H28N4O4Si and a molecular weight of 512.64 g/mol. Its IUPAC name is (2S,3S,4R)-2-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxy-4-methoxy-5-triphenylsilyloxypentanenitrile.
| Compound Name | (2S,3S,4R)-2-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxy-4-methoxy-5-triphenylsilyloxypentanenitrile |
|---|---|
| PubChem CID | 163784328 |
| Molecular Formula | C28H28N4O4Si |
| Molecular Weight | 512.64 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | (2S,3S,4R)-2-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxy-4-methoxy-5-triphenylsilyloxypentanenitrile |
| SMILES | CO[C@H](CO[Si](c1ccccc1)(c1ccccc1)c1ccccc1)[C@@H](O)[C@H](C#N)n1ccc(N)nc1=O |
| InChI | InChI=1S/C28H28N4O4Si/c1-35-25(27(33)24(19-29)32-18-17-26(30)31-28(32)34)20-36-37(21-11-5-2-6-12-21,22-13-7-3-8-14-22)23-15-9-4-10-16-23/h2-18,24-25,27,33H,20H2,1H3,(H2,30,31,34)/t24-,25+,27-/m0/s1 |
| InChIKey | MRGAZNGILNAVSF-WEWMWRJBSA-N |
| XLogP | 0.95 |
| TPSA | 123.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.64 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|