C8H13N3O2S — CID 91162664
4-amino-1-(1-methoxy-2-methylsulfanylethyl)pyrimidin-2-one (PubChem CID 91162664) has the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. Its IUPAC name is 4-amino-1-(1-methoxy-2-methylsulfanylethyl)pyrimidin-2-one.
| Compound Name | 4-amino-1-(1-methoxy-2-methylsulfanylethyl)pyrimidin-2-one |
|---|---|
| PubChem CID | 91162664 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 4-amino-1-(1-methoxy-2-methylsulfanylethyl)pyrimidin-2-one |
| SMILES | COC(CSC)n1ccc(N)nc1=O |
| InChI | InChI=1S/C8H13N3O2S/c1-13-7(5-14-2)11-4-3-6(9)10-8(11)12/h3-4,7H,5H2,1-2H3,(H2,9,10,12) |
| InChIKey | OFBQZWITLANDAD-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |