About [2-[1-(4-amino-2-oxopyrimidin-1-yl)ethoxy]-1,4-dihydroxypentan-3-yl] 2-amino-3-methylbutanoate
[2-[1-(4-amino-2-oxopyrimidin-1-yl)ethoxy]-1,4-dihydroxypentan-3-yl] 2-amino-3-methylbutanoate (PubChem CID 70998723) has the molecular formula C16H28N4O6
and a molecular weight of 372.42 g/mol. Its IUPAC name is [2-[1-(4-amino-2-oxopyrimidin-1-yl)ethoxy]-1,4-dihydroxypentan-3-yl] 2-amino-3-methylbutanoate.
Molecular Properties
| Compound Name | [2-[1-(4-amino-2-oxopyrimidin-1-yl)ethoxy]-1,4-dihydroxypentan-3-yl] 2-amino-3-methylbutanoate |
| PubChem CID | 70998723 |
| Molecular Formula | C16H28N4O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | [2-[1-(4-amino-2-oxopyrimidin-1-yl)ethoxy]-1,4-dihydroxypentan-3-yl] 2-amino-3-methylbutanoate |
| SMILES | CC(C)C(N)C(=O)OC(C(C)O)C(CO)OC(C)n1ccc(N)nc1=O |
| InChI | InChI=1S/C16H28N4O6/c1-8(2)13(18)15(23)26-14(9(3)22)11(7-21)25-10(4)20-6-5-12(17)19-16(20)24/h5-6,8-11,13-14,21-22H,7,18H2,1-4H3,(H2,17,19,24) |
| InChIKey | RBMUTEUYUHSERP-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 162.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze [2-[1-(4-amino-2-oxopyrimidin-1-yl)ethoxy]-1,4-dihydroxypentan-3-yl] 2-amino-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[1-(4-amino-2-oxopyrimidin-1-yl)ethoxy]-1,4-dihydroxypentan-3-yl] 2-amino-3-methylbutanoate?
The IUPAC name of [2-[1-(4-amino-2-oxopyrimidin-1-yl)ethoxy]-1,4-dihydroxypentan-3-yl] 2-amino-3-methylbutanoate (CID 70998723) is [2-[1-(4-amino-2-oxopyrimidin-1-yl)ethoxy]-1,4-dihydroxypentan-3-yl] 2-amino-3-methylbutanoate.
What is the SMILES notation for [2-[1-(4-amino-2-oxopyrimidin-1-yl)ethoxy]-1,4-dihydroxypentan-3-yl] 2-amino-3-methylbutanoate?
The canonical SMILES for [2-[1-(4-amino-2-oxopyrimidin-1-yl)ethoxy]-1,4-dihydroxypentan-3-yl] 2-amino-3-methylbutanoate is CC(C)C(N)C(=O)OC(C(C)O)C(CO)OC(C)n1ccc(N)nc1=O.
What is the InChIKey of [2-[1-(4-amino-2-oxopyrimidin-1-yl)ethoxy]-1,4-dihydroxypentan-3-yl] 2-amino-3-methylbutanoate?
The InChIKey is RBMUTEUYUHSERP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N4O6/c1-8(2)13(18)15(23)26-14(9(3)22)11(7-21)25-10(4)20-6-5-12(17)19-16(20)24/h5-6,8-11,13-14,21-22H,7,18H2,1-4H3,(H2,17,19,24).
What are the key properties of [2-[1-(4-amino-2-oxopyrimidin-1-yl)ethoxy]-1,4-dihydroxypentan-3-yl] 2-amino-3-methylbutanoate?
[2-[1-(4-amino-2-oxopyrimidin-1-yl)ethoxy]-1,4-dihydroxypentan-3-yl] 2-amino-3-methylbutanoate has a molecular weight of 372.42 g/mol, XLogP of -1.00, 9 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[1-(4-amino-2-oxopyrimidin-1-yl)ethoxy]-1,4-dihydroxypentan-3-yl] 2-amino-3-methylbutanoate is sourced from PubChem (CID 70998723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).