C12H22N3O7P — CID 177191498
2-[(1R,2S)-1-(4-amino-2-oxopyrimidin-1-yl)-2-hydroxypropoxy]butyl methyl hydrogen phosphate (PubChem CID 177191498) has the molecular formula C12H22N3O7P and a molecular weight of 351.30 g/mol. Its IUPAC name is 2-[(1R,2S)-1-(4-amino-2-oxopyrimidin-1-yl)-2-hydroxypropoxy]butyl methyl hydrogen phosphate.
| Compound Name | 2-[(1R,2S)-1-(4-amino-2-oxopyrimidin-1-yl)-2-hydroxypropoxy]butyl methyl hydrogen phosphate |
|---|---|
| PubChem CID | 177191498 |
| Molecular Formula | C12H22N3O7P |
| Molecular Weight | 351.30 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 2-[(1R,2S)-1-(4-amino-2-oxopyrimidin-1-yl)-2-hydroxypropoxy]butyl methyl hydrogen phosphate |
| SMILES | CCC(COP(=O)(O)OC)O[C@H]([C@H](C)O)n1ccc(N)nc1=O |
| InChI | InChI=1S/C12H22N3O7P/c1-4-9(7-21-23(18,19)20-3)22-11(8(2)16)15-6-5-10(13)14-12(15)17/h5-6,8-9,11,16H,4,7H2,1-3H3,(H,18,19)(H2,13,14,17)/t8-,9?,11+/m0/s1 |
| InChIKey | PQOSDNXFVDDDOM-PGIIIRCOSA-N |
| XLogP | 0.26 |
| TPSA | 146.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.30 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|