C10H16N3O5P — CID 67784718
[(1R,3S)-3-(4-amino-2-oxopyrimidin-1-yl)cyclopentyl]oxymethylphosphonic acid (PubChem CID 67784718) has the molecular formula C10H16N3O5P and a molecular weight of 289.23 g/mol. Its IUPAC name is [(1R,3S)-3-(4-amino-2-oxopyrimidin-1-yl)cyclopentyl]oxymethylphosphonic acid.
| Compound Name | [(1R,3S)-3-(4-amino-2-oxopyrimidin-1-yl)cyclopentyl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 67784718 |
| Molecular Formula | C10H16N3O5P |
| Molecular Weight | 289.23 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | [(1R,3S)-3-(4-amino-2-oxopyrimidin-1-yl)cyclopentyl]oxymethylphosphonic acid |
| SMILES | Nc1ccn([C@H]2CC[C@@H](OCP(=O)(O)O)C2)c(=O)n1 |
| InChI | InChI=1S/C10H16N3O5P/c11-9-3-4-13(10(14)12-9)7-1-2-8(5-7)18-6-19(15,16)17/h3-4,7-8H,1-2,5-6H2,(H2,11,12,14)(H2,15,16,17)/t7-,8+/m0/s1 |
| InChIKey | UGURDPCLPXCFNA-JGVFFNPUSA-N |
| XLogP | 0.07 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.23 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|