C10H16N4O2 — CID 142192955
4-amino-1-[(3S)-3-amino-3-(hydroxymethyl)cyclopentyl]pyrimidin-2-one (PubChem CID 142192955) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 4-amino-1-[(3S)-3-amino-3-(hydroxymethyl)cyclopentyl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(3S)-3-amino-3-(hydroxymethyl)cyclopentyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 142192955 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 4-amino-1-[(3S)-3-amino-3-(hydroxymethyl)cyclopentyl]pyrimidin-2-one |
| SMILES | Nc1ccn(C2CC[C@@](N)(CO)C2)c(=O)n1 |
| InChI | InChI=1S/C10H16N4O2/c11-8-2-4-14(9(16)13-8)7-1-3-10(12,5-7)6-15/h2,4,7,15H,1,3,5-6,12H2,(H2,11,13,16)/t7?,10-/m0/s1 |
| InChIKey | NSMKBBJRRXJDOF-MHPPCMCBSA-N |
| XLogP | -0.76 |
| TPSA | 107.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |