C13H19N3O3 — CID 3013709
4-amino-1-[(1R)-4,4-bis(hydroxymethyl)-2,3-dimethylcyclopent-2-en-1-yl]pyrimidin-2-one (PubChem CID 3013709) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is 4-amino-1-[(1R)-4,4-bis(hydroxymethyl)-2,3-dimethylcyclopent-2-en-1-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(1R)-4,4-bis(hydroxymethyl)-2,3-dimethylcyclopent-2-en-1-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 3013709 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 4-amino-1-[(1R)-4,4-bis(hydroxymethyl)-2,3-dimethylcyclopent-2-en-1-yl]pyrimidin-2-one |
| SMILES | CC1=C(C)C(CO)(CO)C[C@H]1n1ccc(N)nc1=O |
| InChI | InChI=1S/C13H19N3O3/c1-8-9(2)13(6-17,7-18)5-10(8)16-4-3-11(14)15-12(16)19/h3-4,10,17-18H,5-7H2,1-2H3,(H2,14,15,19)/t10-/m1/s1 |
| InChIKey | GXBMDZSWGKYSFC-SNVBAGLBSA-N |
| XLogP | 0.08 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|