C16H17N3O3 — CID 3013094
4-amino-1-[(2R,5R)-5-(hydroxymethyl)-3-methyl-5-phenyl-2H-furan-2-yl]pyrimidin-2-one (PubChem CID 3013094) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is 4-amino-1-[(2R,5R)-5-(hydroxymethyl)-3-methyl-5-phenyl-2H-furan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,5R)-5-(hydroxymethyl)-3-methyl-5-phenyl-2H-furan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 3013094 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 4-amino-1-[(2R,5R)-5-(hydroxymethyl)-3-methyl-5-phenyl-2H-furan-2-yl]pyrimidin-2-one |
| SMILES | CC1=C[C@](CO)(c2ccccc2)O[C@H]1n1ccc(N)nc1=O |
| InChI | InChI=1S/C16H17N3O3/c1-11-9-16(10-20,12-5-3-2-4-6-12)22-14(11)19-8-7-13(17)18-15(19)21/h2-9,14,20H,10H2,1H3,(H2,17,18,21)/t14-,16+/m1/s1 |
| InChIKey | FWSSTPYALQQPCQ-ZBFHGGJFSA-N |
| XLogP | 1.19 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|