C9H14N3O4P — CID 102435004
4-amino-1-[(1R,3S,4S)-4-hydroxy-1-(hydroxymethyl)-1-oxo-1λ5-phospholan-3-yl]pyrimidin-2-one (PubChem CID 102435004) has the molecular formula C9H14N3O4P and a molecular weight of 259.20 g/mol. Its IUPAC name is 4-amino-1-[(1R,3S,4S)-4-hydroxy-1-(hydroxymethyl)-1-oxo-1λ5-phospholan-3-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(1R,3S,4S)-4-hydroxy-1-(hydroxymethyl)-1-oxo-1λ5-phospholan-3-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 102435004 |
| Molecular Formula | C9H14N3O4P |
| Molecular Weight | 259.20 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 4-amino-1-[(1R,3S,4S)-4-hydroxy-1-(hydroxymethyl)-1-oxo-1λ5-phospholan-3-yl]pyrimidin-2-one |
| SMILES | Nc1ccn([C@@H]2C[P@](=O)(CO)C[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H14N3O4P/c10-8-1-2-12(9(15)11-8)6-3-17(16,5-13)4-7(6)14/h1-2,6-7,13-14H,3-5H2,(H2,10,11,15)/t6-,7-,17-/m1/s1 |
| InChIKey | UITUSCLXKGDTDU-ALOAVZFJSA-N |
| XLogP | -0.95 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.20 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|