C14H22N3O7P — CID 118431512
methyl 2-[(1R,3S)-3-(4-amino-2-oxopyrimidin-1-yl)cyclopentyl]oxy-2-dimethoxyphosphorylacetate (PubChem CID 118431512) has the molecular formula C14H22N3O7P and a molecular weight of 375.32 g/mol. Its IUPAC name is methyl 2-[(1R,3S)-3-(4-amino-2-oxopyrimidin-1-yl)cyclopentyl]oxy-2-dimethoxyphosphorylacetate.
| Compound Name | methyl 2-[(1R,3S)-3-(4-amino-2-oxopyrimidin-1-yl)cyclopentyl]oxy-2-dimethoxyphosphorylacetate |
|---|---|
| PubChem CID | 118431512 |
| Molecular Formula | C14H22N3O7P |
| Molecular Weight | 375.32 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | methyl 2-[(1R,3S)-3-(4-amino-2-oxopyrimidin-1-yl)cyclopentyl]oxy-2-dimethoxyphosphorylacetate |
| SMILES | COC(=O)C(O[C@@H]1CC[C@H](n2ccc(N)nc2=O)C1)P(=O)(OC)OC |
| InChI | InChI=1S/C14H22N3O7P/c1-21-12(18)13(25(20,22-2)23-3)24-10-5-4-9(8-10)17-7-6-11(15)16-14(17)19/h6-7,9-10,13H,4-5,8H2,1-3H3,(H2,15,16,19)/t9-,10+,13?/m0/s1 |
| InChIKey | RVPLUQQVHYELTN-RGPRDZHESA-N |
| XLogP | 0.92 |
| TPSA | 131.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|