C12H20N3O6P — CID 14755650
[5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxymethyl-ethoxyphosphinic acid (PubChem CID 14755650) has the molecular formula C12H20N3O6P and a molecular weight of 333.28 g/mol. Its IUPAC name is [5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxymethyl-ethoxyphosphinic acid.
| Compound Name | [5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxymethyl-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 14755650 |
| Molecular Formula | C12H20N3O6P |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | [5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxymethyl-ethoxyphosphinic acid |
| SMILES | CCOP(=O)(O)COCC1CCC(n2ccc(N)nc2=O)O1 |
| InChI | InChI=1S/C12H20N3O6P/c1-2-20-22(17,18)8-19-7-9-3-4-11(21-9)15-6-5-10(13)14-12(15)16/h5-6,9,11H,2-4,7-8H2,1H3,(H,17,18)(H2,13,14,16) |
| InChIKey | JHLORDHGMOXGTJ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|