C10H16N3O8P — CID 59795978
[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]oxymethylphosphonic acid (PubChem CID 59795978) has the molecular formula C10H16N3O8P and a molecular weight of 337.23 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]oxymethylphosphonic acid.
| Compound Name | [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 59795978 |
| Molecular Formula | C10H16N3O8P |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]oxymethylphosphonic acid |
| SMILES | C[C@@]1(n2ccc(N)nc2=O)O[C@H](OCP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H16N3O8P/c1-10(13-3-2-5(11)12-9(13)16)7(15)6(14)8(21-10)20-4-22(17,18)19/h2-3,6-8,14-15H,4H2,1H3,(H2,11,12,16)(H2,17,18,19)/t6-,7+,8-,10+/m0/s1 |
| InChIKey | ONAZSRBNKUBFFW-PYHGXSLLSA-N |
| XLogP | -2.27 |
| TPSA | 177.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|