C9H16N3O15P3 — CID 170160648
[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4,5-trihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 170160648) has the molecular formula C9H16N3O15P3 and a molecular weight of 499.16 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4,5-trihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4,5-trihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 170160648 |
| Molecular Formula | C9H16N3O15P3 |
| Molecular Weight | 499.16 g/mol |
| Exact Mass | 498.98 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4,5-trihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Nc1ccn([C@]2(O)O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H16N3O15P3/c10-5-1-2-12(8(15)11-5)9(16)7(14)6(13)4(25-9)3-24-29(20,21)27-30(22,23)26-28(17,18)19/h1-2,4,6-7,13-14,16H,3H2,(H,20,21)(H,22,23)(H2,10,11,15)(H2,17,18,19)/t4-,6-,7-,9-/m1/s1 |
| InChIKey | UNAQQKLYMRGZHO-FJGDRVTGSA-N |
| XLogP | -3.11 |
| TPSA | 290.65 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.16 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|