C11H16F4N3O13P3 — CID 126723787
[[(2R,3R,4R)-4-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-2-(2,2,2-trifluoroethyl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 126723787) has the molecular formula C11H16F4N3O13P3 and a molecular weight of 567.17 g/mol. Its IUPAC name is [[(2R,3R,4R)-4-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-2-(2,2,2-trifluoroethyl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4R)-4-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-2-(2,2,2-trifluoroethyl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 126723787 |
| Molecular Formula | C11H16F4N3O13P3 |
| Molecular Weight | 567.17 g/mol |
| Exact Mass | 566.98 |
| IUPAC Name | [[(2R,3R,4R)-4-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-2-(2,2,2-trifluoroethyl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Nc1ccn([C@@]2(F)CO[C@@](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)(CC(F)(F)F)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C11H16F4N3O13P3/c12-10(18-2-1-6(16)17-8(18)20)5-28-9(7(10)19,3-11(13,14)15)4-29-33(24,25)31-34(26,27)30-32(21,22)23/h1-2,7,19H,3-5H2,(H,24,25)(H,26,27)(H2,16,17,20)(H2,21,22,23)/t7-,9-,10+/m1/s1 |
| InChIKey | KMKHXJJFOYEYAR-QNSHHTMESA-N |
| XLogP | -0.13 |
| TPSA | 250.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.17 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|