C10H15F2N6O13P3 — CID 134366203
[[(2R,3R,4S)-4-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-2-(azidomethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 134366203) has the molecular formula C10H15F2N6O13P3 and a molecular weight of 558.18 g/mol. Its IUPAC name is [[(2R,3R,4S)-4-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-2-(azidomethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4S)-4-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-2-(azidomethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 134366203 |
| Molecular Formula | C10H15F2N6O13P3 |
| Molecular Weight | 558.18 g/mol |
| Exact Mass | 557.99 |
| IUPAC Name | [[(2R,3R,4S)-4-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-2-(azidomethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | [N-]=[N+]=NC[C@]1(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)OC[C@@](F)(n2cc(F)c(N)nc2=O)[C@@H]1O |
| InChI | InChI=1S/C10H15F2N6O13P3/c11-5-1-18(8(20)16-6(5)13)10(12)4-28-9(7(10)19,2-15-17-14)3-29-33(24,25)31-34(26,27)30-32(21,22)23/h1,7,19H,2-4H2,(H,24,25)(H,26,27)(H2,13,16,20)(H2,21,22,23)/t7-,9-,10-/m1/s1 |
| InChIKey | FYWATKNQXWUJQU-SZEHBUNVSA-N |
| XLogP | -0.63 |
| TPSA | 298.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.18 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|