C11H18FN6O13P3 — CID 118013005
[[(2R,3R,4S,5R)-5-(4-amino-2-methylidenepyrimidin-1-yl)-2-(azidomethyl)-4-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 118013005) has the molecular formula C11H18FN6O13P3 and a molecular weight of 554.21 g/mol. Its IUPAC name is [[(2R,3R,4S,5R)-5-(4-amino-2-methylidenepyrimidin-1-yl)-2-(azidomethyl)-4-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4S,5R)-5-(4-amino-2-methylidenepyrimidin-1-yl)-2-(azidomethyl)-4-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 118013005 |
| Molecular Formula | C11H18FN6O13P3 |
| Molecular Weight | 554.21 g/mol |
| Exact Mass | 554.01 |
| IUPAC Name | [[(2R,3R,4S,5R)-5-(4-amino-2-methylidenepyrimidin-1-yl)-2-(azidomethyl)-4-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C=C1N=C(N)C=CN1[C@@H]1O[C@](CN=[N+]=[N-])(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@]1(O)F |
| InChI | InChI=1S/C11H18FN6O13P3/c1-6-16-7(13)2-3-18(6)9-11(12,20)8(19)10(29-9,4-15-17-14)5-28-33(24,25)31-34(26,27)30-32(21,22)23/h2-3,8-9,19-20H,1,4-5H2,(H2,13,16)(H,24,25)(H,26,27)(H2,21,22,23)/t8-,9-,10-,11-/m1/s1 |
| InChIKey | RLMLKCBACLCSDI-GWOFURMSSA-N |
| XLogP | -0.59 |
| TPSA | 299.89 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.21 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|