C11H13F2N3O9P2 — CID 164881953
[(2R,5S)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-5-ethynyl-2-fluorooxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 164881953) has the molecular formula C11H13F2N3O9P2 and a molecular weight of 431.18 g/mol. Its IUPAC name is [(2R,5S)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-5-ethynyl-2-fluorooxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,5S)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-5-ethynyl-2-fluorooxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 164881953 |
| Molecular Formula | C11H13F2N3O9P2 |
| Molecular Weight | 431.18 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | [(2R,5S)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-5-ethynyl-2-fluorooxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | C#C[C@]1(n2cc(F)c(N)nc2=O)CC[C@@](F)(COP(=O)(O)OP(=O)(O)O)O1 |
| InChI | InChI=1S/C11H13F2N3O9P2/c1-2-11(16-5-7(12)8(14)15-9(16)17)4-3-10(13,24-11)6-23-27(21,22)25-26(18,19)20/h1,5H,3-4,6H2,(H,21,22)(H2,14,15,17)(H2,18,19,20)/t10-,11+/m0/s1 |
| InChIKey | MZGGZKWLOXAPOI-WDEREUQCSA-N |
| XLogP | -0.05 |
| TPSA | 183.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.18 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|