C12H21N4O14P3 — CID 140528529
[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-5-(3-aminoprop-2-enyl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 140528529) has the molecular formula C12H21N4O14P3 and a molecular weight of 538.24 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-5-(3-aminoprop-2-enyl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-5-(3-aminoprop-2-enyl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 140528529 |
| Molecular Formula | C12H21N4O14P3 |
| Molecular Weight | 538.24 g/mol |
| Exact Mass | 538.03 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-5-(3-aminoprop-2-enyl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | NC=CC[C@@]1(n2ccc(N)nc2=O)O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H21N4O14P3/c13-4-1-3-12(16-5-2-8(14)15-11(16)19)10(18)9(17)7(28-12)6-27-32(23,24)30-33(25,26)29-31(20,21)22/h1-2,4-5,7,9-10,17-18H,3,6,13H2,(H,23,24)(H,25,26)(H2,14,15,19)(H2,20,21,22)/t7-,9-,10-,12-/m1/s1 |
| InChIKey | GGJGOUNREUVWQI-UGKPPGOTSA-N |
| XLogP | -2.20 |
| TPSA | 296.44 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.24 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|