C10H15N3O10P2 — CID 87924119
[(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxy-4-methylideneoxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 87924119) has the molecular formula C10H15N3O10P2 and a molecular weight of 399.19 g/mol. Its IUPAC name is [(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxy-4-methylideneoxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxy-4-methylideneoxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 87924119 |
| Molecular Formula | C10H15N3O10P2 |
| Molecular Weight | 399.19 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | [(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxy-4-methylideneoxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | C=C1C(O)[C@@H](COP(=O)(O)OP(=O)(O)O)O[C@H]1n1ccc(N)nc1=O |
| InChI | InChI=1S/C10H15N3O10P2/c1-5-8(14)6(4-21-25(19,20)23-24(16,17)18)22-9(5)13-3-2-7(11)12-10(13)15/h2-3,6,8-9,14H,1,4H2,(H,19,20)(H2,11,12,15)(H2,16,17,18)/t6-,8?,9-/m1/s1 |
| InChIKey | VZVCBQNYRNQQAR-CQTSCFDVSA-N |
| XLogP | -1.13 |
| TPSA | 203.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.19 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|