C14H19N3O5 — CID 15009337
[(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxy-4-methylideneoxolan-2-yl]methyl butanoate (PubChem CID 15009337) has the molecular formula C14H19N3O5 and a molecular weight of 309.32 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxy-4-methylideneoxolan-2-yl]methyl butanoate.
| Compound Name | [(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxy-4-methylideneoxolan-2-yl]methyl butanoate |
|---|---|
| PubChem CID | 15009337 |
| Molecular Formula | C14H19N3O5 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | [(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxy-4-methylideneoxolan-2-yl]methyl butanoate |
| SMILES | C=C1[C@H](n2ccc(N)nc2=O)O[C@H](COC(=O)CCC)[C@H]1O |
| InChI | InChI=1S/C14H19N3O5/c1-3-4-11(18)21-7-9-12(19)8(2)13(22-9)17-6-5-10(15)16-14(17)20/h5-6,9,12-13,19H,2-4,7H2,1H3,(H2,15,16,20)/t9-,12+,13-/m1/s1 |
| InChIKey | UUALODNDGXVHEC-JIMOISOXSA-N |
| XLogP | -0.02 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|