C13H17N3O4 — CID 70382951
[(2S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methyl butanoate (PubChem CID 70382951) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is [(2S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methyl butanoate.
| Compound Name | [(2S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methyl butanoate |
|---|---|
| PubChem CID | 70382951 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | [(2S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methyl butanoate |
| SMILES | CCCC(=O)OC[C@@H]1C=C[C@H](n2ccc(N)nc2=O)O1 |
| InChI | InChI=1S/C13H17N3O4/c1-2-3-12(17)19-8-9-4-5-11(20-9)16-7-6-10(14)15-13(16)18/h4-7,9,11H,2-3,8H2,1H3,(H2,14,15,18)/t9-,11+/m0/s1 |
| InChIKey | ATQAJXHYHNBGKC-GXSJLCMTSA-N |
| XLogP | 0.62 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|