C11H15ClN3O13P3 — CID 145393440
[[(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-chloro-4-ethynyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 145393440) has the molecular formula C11H15ClN3O13P3 and a molecular weight of 525.62 g/mol. Its IUPAC name is [[(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-chloro-4-ethynyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-chloro-4-ethynyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 145393440 |
| Molecular Formula | C11H15ClN3O13P3 |
| Molecular Weight | 525.62 g/mol |
| Exact Mass | 524.95 |
| IUPAC Name | [[(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-chloro-4-ethynyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C#CC1(Cl)C(O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1n1ccc(N)nc1=O |
| InChI | InChI=1S/C11H15ClN3O13P3/c1-2-11(12)8(16)6(26-9(11)15-4-3-7(13)14-10(15)17)5-25-30(21,22)28-31(23,24)27-29(18,19)20/h1,3-4,6,8-9,16H,5H2,(H,21,22)(H,23,24)(H2,13,14,17)(H2,18,19,20)/t6-,8?,9-,11?/m1/s1 |
| InChIKey | XHEBNBRSDDDJBZ-JPRQMENOSA-N |
| XLogP | -0.96 |
| TPSA | 250.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.62 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|